N-(9,10-dioxoanthracen-2-yl)formamide structure
|
Common Name | N-(9,10-dioxoanthracen-2-yl)formamide | ||
|---|---|---|---|---|
| CAS Number | 73292-53-2 | Molecular Weight | 251.23700 | |
| Density | 1.428g/cm3 | Boiling Point | 541.1ºC at 760 mmHg | |
| Molecular Formula | C15H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | N-(9,10-dioxoanthracen-2-yl)formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760 mmHg |
| Molecular Formula | C15H9NO3 |
| Molecular Weight | 251.23700 |
| Flash Point | 232.5ºC |
| Exact Mass | 251.05800 |
| PSA | 63.24000 |
| LogP | 2.73920 |
| Index of Refraction | 1.706 |
| InChIKey | PCWYOCSEPDZANF-UHFFFAOYSA-N |
| SMILES | O=CNc1ccc2c(c1)C(=O)c1ccccc1C2=O |
|
~%
N-(9,10-dioxoan... CAS#:73292-53-2 |
| Literature: Bradley; Leete Journal of the Chemical Society, 1951 , p. 2129 Journal of the Society of Dyers and Colourists, 1954 , vol. 70, p. 59 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(9,10-dioxo-2-anthracenyl)formamide |
| 2-Formylamino-anthrachinon |
| n-(9,10-dioxo-9,10-dihydroanthracen-2-yl)formamide |
| 2-Formamino-anthrachinon |
| N-(9,10-dioxo-9,10-dihydro-[2]anthryl)-formamide |