Benzene,1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl] structure
|
Common Name | Benzene,1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 733-07-3 | Molecular Weight | 252.39400 | |
| Density | 0.947g/cm3 | Boiling Point | 370.7ºC at 760 mmHg | |
| Molecular Formula | C19H24 | Melting Point | 132-135ºC | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 1,3,5-trimethyl-2-[(2,4,6-trimethylphenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.947g/cm3 |
|---|---|
| Boiling Point | 370.7ºC at 760 mmHg |
| Melting Point | 132-135ºC |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.39400 |
| Flash Point | 192.8ºC |
| Exact Mass | 252.18800 |
| LogP | 5.12780 |
| Index of Refraction | 1.547 |
| InChIKey | ZQYQPPLKPFBKLD-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Cc2c(C)cc(C)cc2C)c(C)c1 |
| Safety Phrases | S22-S24/25 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,1'-Methylenebis(2,4,6-trimethylbenzene) |
| dimesityl-methane |
| Benzene,1'-methylenebis[2,4,6-trimethyl |
| EINECS 211-991-6 |
| MFCD00014913 |
| bis(mesityl)methane |
| Benzene,1,1'-methylenebis[2,4,6-trimethyl |
| bis(2,4,6-trimethylphenyl)methane |
| Dimesitylmethan |