(4-((benzylsulfinyl)methyl)phenyl)(hydroxy)azane oxide structure
|
Common Name | (4-((benzylsulfinyl)methyl)phenyl)(hydroxy)azane oxide | ||
|---|---|---|---|---|
| CAS Number | 73318-12-4 | Molecular Weight | 275.32300 | |
| Density | 1.347g/cm3 | Boiling Point | 534.7ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.2ºC | |
| Name | 1-(benzylsulfinylmethyl)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 534.7ºC at 760 mmHg |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.32300 |
| Flash Point | 277.2ºC |
| Exact Mass | 275.06200 |
| PSA | 82.10000 |
| LogP | 4.43260 |
| Index of Refraction | 1.663 |
| InChIKey | QXCMIJOWNYUJSB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CS(=O)Cc2ccccc2)cc1 |
|
~%
(4-((benzylsulf... CAS#:73318-12-4 |
| Literature: Leandri et al. Journal of the Chemical Society, 1957 , p. 1386,1389 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| benzyl-(4-nitro-benzyl)-sulfoxide |
| 1-[(benzylsulfinyl)methyl]-4-nitrobenzene |