2-(2-methylpropyl)naphthalene-1,4-dione structure
|
Common Name | 2-(2-methylpropyl)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 73377-70-5 | Molecular Weight | 214.26000 | |
| Density | 1.118g/cm3 | Boiling Point | 338.3ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.9ºC | |
| Name | 2-(2-methylpropyl)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 338.3ºC at 760 mmHg |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 126.9ºC |
| Exact Mass | 214.09900 |
| PSA | 34.14000 |
| LogP | 3.03810 |
| Index of Refraction | 1.554 |
| InChIKey | WOEIWIRKOWGTMQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC(=O)c2ccccc2C1=O |
|
~75%
2-(2-methylprop... CAS#:73377-70-5 |
| Literature: Pluim, Henk; Wynberg, Hans Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2498 - 2502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Naphthalenedione,2-(2-methylpropyl) |
| 2-Isobutyl-1,4-naphthoquinone |