N-diphenylphosphorylhydroxylamine structure
|
Common Name | N-diphenylphosphorylhydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 73452-52-5 | Molecular Weight | 233.20300 | |
| Density | 1.28g/cm3 | Boiling Point | 396ºC at 760 mmHg | |
| Molecular Formula | C12H12NO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.3ºC | |
| Name | N-diphenylphosphorylhydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 396ºC at 760 mmHg |
| Molecular Formula | C12H12NO2P |
| Molecular Weight | 233.20300 |
| Flash Point | 193.3ºC |
| Exact Mass | 233.06100 |
| PSA | 59.14000 |
| LogP | 2.28520 |
| Index of Refraction | 1.614 |
| InChIKey | NJKRDPIHNOWVJI-UHFFFAOYSA-N |
| SMILES | O=P(NO)(c1ccccc1)c1ccccc1 |
|
~%
N-diphenylphosp... CAS#:73452-52-5 |
| Literature: Cates,L.A. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 382 - 383 |
|
~%
N-diphenylphosp... CAS#:73452-52-5 |
| Literature: Harger, Martin J. P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2699 - 2704 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| N-hydroxy-P,P-diphenylphosphinic amide |
| N-(Diphenylphosphinyl)hydroxylamine |
| diphenylphosphinylhydroxylamine |
| N-(Diphenyl-phosphinyl)-hydroxylamin |
| N-(diphenylphosphinoyl)hydroxylamine |