podophyllotoxin, secodeoxy cyclic ether structure
|
Common Name | podophyllotoxin, secodeoxy cyclic ether | ||
|---|---|---|---|---|
| CAS Number | 73465-38-0 | Molecular Weight | 386.43800 | |
| Density | 1.209g/cm3 | Boiling Point | 507.3ºC at 760mmHg | |
| Molecular Formula | C22H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | podophyllotoxin, secodeoxy cyclic ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 507.3ºC at 760mmHg |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.43800 |
| Flash Point | 205ºC |
| Exact Mass | 386.17300 |
| PSA | 55.38000 |
| LogP | 3.48890 |
| InChIKey | VJMJISPSGHVBBU-UHFFFAOYSA-N |
| SMILES | COc1cc(CC2COCC2Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
|
~%
podophyllotoxin... CAS#:73465-38-0 |
| Literature: Tomioka; Ishiguro; Koga Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 10 p. 4333 - 4337 |
|
~%
podophyllotoxin... CAS#:73465-38-0 |
| Literature: Tomioka; Ishiguro; Koga Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 10 p. 4333 - 4337 |
|
~%
podophyllotoxin... CAS#:73465-38-0 |
| Literature: Tomioka; Ishiguro; Koga Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 10 p. 4333 - 4337 |
|
~33%
podophyllotoxin... CAS#:73465-38-0 |
| Literature: Tomioka; Ishiguro; Koga Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 10 p. 4333 - 4337 |
| 2-NAPHTHYLAMINE,1,2,3,4-TETRAHYDRO-N-CYCLOPROPYL-5-METHOXY-1-METHYL |
| (+)-cis-burseran |
| (+-)-cis-6,6a,11,11a-tetrahydro-5H-benzo[a]carbazole |
| N-Cyclopropyl-5-methoxy-1-methyl-1,2,3,4-tetrahydro-2-naphthylamine |
| (+-)-cis-5-methoxy-1-methyl-2-(N-cyclopropylamino)tetralin |