Ethanone, 1-(4-ethylphenyl)-2,2,2-trifluoro- (9CI) structure
|
Common Name | Ethanone, 1-(4-ethylphenyl)-2,2,2-trifluoro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 73471-96-2 | Molecular Weight | 202.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Ethylphenyl)-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9F3O |
|---|---|
| Molecular Weight | 202.17300 |
| Exact Mass | 202.06100 |
| PSA | 17.07000 |
| LogP | 2.99400 |
| InChIKey | ISFVKKPXBGQFRW-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)C(F)(F)F)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
Ethanone, 1-(4-... CAS#:73471-96-2 |
| Literature: Stewart, Ross; Teo, K. C. Canadian Journal of Chemistry, 1980 , vol. 58, p. 2491 - 2496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Ethyl-2,2,2-trifluoroacetophenone |
| p-Ethyl-trifluoracetophenon |