3-(Trichlorosilyl)propyl methacrylate structure
|
Common Name | 3-(Trichlorosilyl)propyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 7351-61-3 | Molecular Weight | 261.605 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 271.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C7H11Cl3O2Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 118.3±22.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-trichlorosilylpropyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 271.9±23.0 °C at 760 mmHg |
| Molecular Formula | C7H11Cl3O2Si |
| Molecular Weight | 261.605 |
| Flash Point | 118.3±22.6 °C |
| Exact Mass | 259.959381 |
| PSA | 26.30000 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | DOGMJCPBZJUYGB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC[Si](Cl)(Cl)Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | R14 |
| Safety Phrases | S26 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
|
~89%
3-(Trichlorosil... CAS#:7351-61-3 |
| Literature: Efimov, Yu. T.; Tandura, T. A.; Kopylov, V. M.; Androsenko, S. I.; Shkol'nik, M. I. J. Gen. Chem. USSR (Engl. Transl.), 1991 , vol. 61, # 10 p. 2244 - 2253,2083 - 2091 |
|
~%
3-(Trichlorosil... CAS#:7351-61-3 |
| Literature: WO2007/20932 A1, ; Page/Page column 9 ; |
|
Combining dynamic stretch and tunable stiffness to probe cell mechanobiology in vitro.
PLoS ONE 6 , e23272, (2011) Cells have the ability to actively sense their mechanical environment and respond to both substrate stiffness and stretch by altering their adhesion, proliferation, locomotion, morphology, and synthet... |
| (3-Methacryloyloxypropyl)trichlorosilane |
| 2-Propenoic acid,2-methyl-,3-(trichlorosilyl)propyl ester |
| 2-Propenoic acid, 2-methyl-, 3-(trichlorosilyl)propyl ester |
| 3-(Trichlorosilyl)propyl methacrylate |
| Methacrylic acid,3-(trichlorosilyl)propyl ester |
| 3-methacryloxy-propyltrichloro silane |
| 3-(trichlorosilyl)propyl 2-methylprop-2-enoate |
| DSSTox_CID_7647 |