2-CHLORO-6-METHOXYQUINOLINE-3-CARBALDEHYDE structure
|
Common Name | 2-CHLORO-6-METHOXYQUINOLINE-3-CARBALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 73568-29-3 | Molecular Weight | 221.64000 | |
| Density | 1.348g/cm3 | Boiling Point | 373.9ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO2 | Melting Point | 149-151 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 179.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloro-6-methoxyquinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 373.9ºC at 760 mmHg |
| Melting Point | 149-151 °C(lit.) |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64000 |
| Flash Point | 179.9ºC |
| Exact Mass | 221.02400 |
| PSA | 39.19000 |
| LogP | 2.70930 |
| Index of Refraction | 1.657 |
| InChIKey | TZQOMBXDCIPJKW-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(Cl)c(C=O)cc2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-6-methoxyquinoline-3-carbaldehyde |
| MFCD00160585 |