6-CHLORO-2-HYDROXYQUINOLINE-3-CARBALDEHYDE structure
|
Common Name | 6-CHLORO-2-HYDROXYQUINOLINE-3-CARBALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 73568-44-2 | Molecular Weight | 207.61300 | |
| Density | 1.497g/cm3 | Boiling Point | 464.1ºC at 760 mmHg | |
| Molecular Formula | C10H6ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 234.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-chloro-2-oxo-1H-quinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 464.1ºC at 760 mmHg |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.61300 |
| Flash Point | 234.5ºC |
| Exact Mass | 207.00900 |
| PSA | 50.19000 |
| LogP | 2.40630 |
| Index of Refraction | 1.69 |
| InChIKey | CBLORNUIUVMGAS-UHFFFAOYSA-N |
| SMILES | O=Cc1cc2cc(Cl)ccc2[nH]c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
~95%
6-CHLORO-2-HYDR... CAS#:73568-44-2 |
| Literature: Meth-Cohn, Otto; Narine, Bramha; Tarnowski, Brian Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1520 - 1530 |
|
~87%
6-CHLORO-2-HYDR... CAS#:73568-44-2 |
| Literature: Meth-Cohn, Otto; Narine, Bramha; Tarnowski, Brian; Hayes, Roy; Keyzad, Amitis; at al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 2509 - 2517 |
|
~%
6-CHLORO-2-HYDR... CAS#:73568-44-2 |
| Literature: Meth-Cohn, Otto; Narine, Bramha; Tarnowski, Brian Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1520 - 1530 |
|
~%
6-CHLORO-2-HYDR... CAS#:73568-44-2 |
| Literature: Meth-Cohn, Otto; Narine, Bramha; Tarnowski, Brian Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1520 - 1530 |
| 6-chloro-3-formyl-2-quinolone |
| 6-chloro-2-hydroxyquinoline-3-carbaldehyde |