Benzenesulfonylchloride, 3,3'-sulfonylbis
Benzenesulfonylchloride, 3,3'-sulfonylbis structure
|
Common Name | Benzenesulfonylchloride, 3,3'-sulfonylbis | ||
|---|---|---|---|---|
| CAS Number | 7357-41-7 | Molecular Weight | 415.28900 | |
| Density | 1.653g/cm3 | Boiling Point | 617.8ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.653g/cm3 |
|---|---|
| Boiling Point | 617.8ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2O6S3 |
| Molecular Weight | 415.28900 |
| Flash Point | 327.4ºC |
| Exact Mass | 413.88600 |
| PSA | 127.56000 |
| LogP | 5.61680 |
| Index of Refraction | 1.614 |
| InChIKey | JCIFZSCARAOKME-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc(S(=O)(=O)c2cccc(S(=O)(=O)Cl)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
Benzenesulfonyl... CAS#:7357-41-7 |
| Literature: Moskvichev, Yu. A.; Sapunov, V. A.; Mironov, G. S. J. Appl. Chem. USSR (Engl. Transl.), 1980 , vol. 53, # 7 p. 1619 - 1623,1264 - 1268 |
|
~%
Benzenesulfonyl... CAS#:7357-41-7 |
| Literature: Pollak et al. Monatshefte fuer Chemie, 1930 , vol. 55, p. 358,373 |
|
~%
Benzenesulfonyl... CAS#:7357-41-7 |
| Literature: Kirsanow; Kirsanowa Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 1802,1803,1810; engl.Ausg.S.1774,1775,1781 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diphenyl sulfone-3,3'-disulfonyl chloride |
| 3,3'-sulfonyl-bis-benzenesulfonyl chloride |
| Benzenesulfonylchloride,3,3'-sulfonylbis |
| 3,3'-sulfonyldibenzenesulfonyl chloride |
| 3,3'-Sulfonyl-bis-benzolsulfonylchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: The English name of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride. |
| Q: What is the polar surface area (PSA) of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: Polar surface area (PSA) of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is 127.56000. |
| Q: What is the SMILES notation of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: SMILES notation of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is O=S(=O)(Cl)c1cccc(S(=O)(=O)c2cccc(S(=O)(=O)Cl)c2)c1. |
| Q: What is the molecular weight of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: Molecular weight of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is 415.28900. |
| Q: What is the InChIKey of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: InChIKey of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is JCIFZSCARAOKME-UHFFFAOYSA-N. |
| Q: What is the boiling point of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: Boiling point of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is 617.8ºC at 760 mmHg. |
| Q: What is the LogP of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: LogP of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is 5.61680. |
| Q: What are the upstream materials of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: Related upstream materials(CAS) of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride: 127-63-9;71-43-2. |
| Q: What English synonyms does 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride have? |
| A: English synonyms of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride: diphenyl sulfone-3,3'-disulfonyl chloride, 3,3'-sulfonyl-bis-benzenesulfonyl chloride, Benzenesulfonylchloride,3,3'-sulfonylbis, 3,3'-sulfonyldibenzenesulfonyl chloride, 3,3'-Sulfonyl-bis-benzolsulfonylchlorid. |
| Q: What is the molecular formula of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride? |
| A: Molecular formula of 3-(3-chlorosulfonylphenyl)sulfonylbenzenesulfonyl chloride is C12H8Cl2O6S3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |