2,3',4,5'-Tetrachlorobiphenyl
2,3',4,5'-Tetrachlorobiphenyl structure
|
Common Name | 2,3',4,5'-Tetrachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 73575-52-7 | Molecular Weight | 291.98800 | |
| Density | 1.441 g/cm3 | Boiling Point | 362.4ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4 | Melting Point | 106.53°C (estimate) | |
| MSDS | N/A | Flash Point | 174.9ºC | |
Summary: 2,3',4,5'-Tetrachlorobiphenyl, Chinese name: 2,3',4,5'-四氯联苯, CAS number: 73575-52-7, molecular formula: C12H6Cl4, molecular weight: 291.98800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3',4,5'-Tetrachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.441 g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760 mmHg |
| Melting Point | 106.53°C (estimate) |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.98800 |
| Flash Point | 174.9ºC |
| Exact Mass | 289.92200 |
| LogP | 5.96720 |
| Index of Refraction | 1.612 |
| InChIKey | KTTXLLZIBIDUCR-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(-c2ccc(Cl)cc2Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~12%
2,3',4,5'-Tetra... CAS#:73575-52-7 |
| Literature: Kylmaelae, Tuula; Kuuloja, Noora; Xu, Youjun; Rissanen, Kari; Franzen, Robert European Journal of Organic Chemistry, 2008 , # 23 p. 4019 - 4024 |
|
~%
2,3',4,5'-Tetra... CAS#:73575-52-7 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-dichloro-5-(2,4-dichlorophenyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: InChIKey of 2,3',4,5'-Tetrachlorobiphenyl is KTTXLLZIBIDUCR-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: LogP of 2,3',4,5'-Tetrachlorobiphenyl is 5.96720. |
| Q: What is the English name of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: The English name of 2,3',4,5'-Tetrachlorobiphenyl is 2,3',4,5'-Tetrachlorobiphenyl. |
| Q: What is the melting point of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: Melting point of 2,3',4,5'-Tetrachlorobiphenyl is 106.53°C (estimate). |
| Q: What is the molecular weight of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: Molecular weight of 2,3',4,5'-Tetrachlorobiphenyl is 291.98800. |
| Q: What English synonyms does 2,3',4,5'-Tetrachlorobiphenyl have? |
| A: English synonyms of 2,3',4,5'-Tetrachlorobiphenyl: 1,3-dichloro-5-(2,4-dichlorophenyl)benzene. |
| Q: What is the boiling point of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: Boiling point of 2,3',4,5'-Tetrachlorobiphenyl is 362.4ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: SMILES notation of 2,3',4,5'-Tetrachlorobiphenyl is Clc1cc(Cl)cc(-c2ccc(Cl)cc2Cl)c1. |
| Q: What is the CAS number of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: CAS number of 2,3',4,5'-Tetrachlorobiphenyl is 73575-52-7. |
| Q: What is the molecular formula of 2,3',4,5'-Tetrachlorobiphenyl? |
| A: Molecular formula of 2,3',4,5'-Tetrachlorobiphenyl is C12H6Cl4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |