Glyceryl tri(2-ethylhexanoate) structure
|
Common Name | Glyceryl tri(2-ethylhexanoate) | ||
|---|---|---|---|---|
| CAS Number | 7360-38-5 | Molecular Weight | 470.682 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 498.1±12.0 °C at 760 mmHg | |
| Molecular Formula | C27H50O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 204.8±19.6 °C | |
| Name | Glyceryl tri(2-ethylhexanoate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.1±12.0 °C at 760 mmHg |
| Molecular Formula | C27H50O6 |
| Molecular Weight | 470.682 |
| Flash Point | 204.8±19.6 °C |
| Exact Mass | 470.360748 |
| PSA | 78.90000 |
| LogP | 8.77 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | DGSZGZSCHSQXFV-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Hexanoic acid, 2-ethyl-, 1,2,3-propanetriyl ester |
| TRIETHYLHEXANOIN |
| 2-ethylcaproic acid triglyceride |
| Glycerin tris(2-ethylhexanoate) |
| Propane-1,2,3-triyl tris(2-ethylhexanoate) |
| Propan-1,2,3-triyl-2-ethylhexanoat |
| propane-1,2,3-triyl 2-ethylhexanoate |
| EINECS 230-896-0 |
| tris-(2-ethyl-hexanoyloxy)-propane |
| 2-ethyl-hexanoic acid propane-1,2,3-triyl ester |
| Glyceryl tri(2-ethylhexanoate) |
| UNII:7K3W1BIU6K |
| 1,2,3-Propanetriyl tris(2-ethylhexanoate) |
| 1,2,3-<tris(2-ethylhexanoyloxy)>propane |
| Tricaprylin(Trioctanoin) |
| glycerol tri-2-ethyl-hexanoate |
| GLYCEROL TRIS(2-ETHYLHEXANOATE) |
| glyceryltriisocaprylate |