1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride structure
|
Common Name | 1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 73606-13-0 | Molecular Weight | 240.14800 | |
| Density | 1.492g/cm3 | Boiling Point | 112ºC | |
| Molecular Formula | C5H5F5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43.7ºC | |
| Name | 1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 112ºC |
| Molecular Formula | C5H5F5O3S |
| Molecular Weight | 240.14800 |
| Flash Point | 43.7ºC |
| Exact Mass | 239.98800 |
| PSA | 51.75000 |
| LogP | 2.75470 |
| Index of Refraction | 1.367 |
| InChIKey | IMNCTHAFGYFIOE-UHFFFAOYSA-N |
| SMILES | C=CCOC(F)(F)C(F)(F)S(=O)(=O)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
|
~%
1,1,2,2-tetrafl... CAS#:73606-13-0 |
| Literature: Chen, L. F.; Mohtasham, J.; Gard, G. L. Journal of Fluorine Chemistry, 1990 , vol. 46, # 1 p. 21 - 38 |
|
~%
1,1,2,2-tetrafl... CAS#:73606-13-0 |
| Literature: anonymous C.A., Huaxue Xuebao 37 (1978/79) 315/324 1980 , vol. 93, p. 113886 |
|
~%
1,1,2,2-tetrafl... CAS#:73606-13-0 |
| Literature: anonymous C.A., Huaxue Xuebao 37 (1978/79) 315/324 1980 , vol. 93, p. 113886 |
| 2-allyloxy-1,1,2,2-tetrafluoroethanesulfonylfluoride |
| pc9756 |