ethyl 3,4,5-triacetyloxybenzoate structure
|
Common Name | ethyl 3,4,5-triacetyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 73607-60-0 | Molecular Weight | 324.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3,4,5-triacetyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O8 |
|---|---|
| Molecular Weight | 324.28300 |
| Exact Mass | 324.08500 |
| PSA | 105.20000 |
| LogP | 1.63920 |
| InChIKey | APEOYHMMWLHUAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c1 |
|
~%
ethyl 3,4,5-tri... CAS#:73607-60-0 |
| Literature: Schiff Justus Liebigs Annalen der Chemie, 1872 , vol. 163, p. 218 Chemische Berichte, 1879 , vol. 12, p. 1533 Show Details Power; Shedden Journal of the Chemical Society, 1902 , vol. 81, p. 74,75 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Triacetyl-gallussaeure-aethylester |
| Triacetylgallussaeureethylester |
| Gallussaeureaethylesteracetat |
| Benzoic acid,3,4,5-tris(acetyloxy)-,ethyl ester |
| 3,4,5-Triacetoxy-benzoesaeure-aethylester |
| ethyl 3,4,5-triacetoxybenzoate |
| Ethyl-3.4.5-trihydroxybenzoattriacetat |
| 3,4,5-triacetoxy-benzoic acid ethyl ester |
| 5-(ethoxycarbonyl)benzene-1,2,3-triyl triacetate |