rufigallol structure
|
Common Name | rufigallol | ||
|---|---|---|---|---|
| CAS Number | 82-12-2 | Molecular Weight | 304.20900 | |
| Density | 2.032g/cm3 | Boiling Point | 524.9ºC at 760 mmHg | |
| Molecular Formula | C14H8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.3ºC | |
| Name | rufigallol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.032g/cm3 |
|---|---|
| Boiling Point | 524.9ºC at 760 mmHg |
| Molecular Formula | C14H8O8 |
| Molecular Weight | 304.20900 |
| Flash Point | 285.3ºC |
| Exact Mass | 304.02200 |
| PSA | 155.52000 |
| LogP | 0.69560 |
| Index of Refraction | 1.906 |
| InChIKey | NEIMTOOWBACOHT-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(O)c(O)c(O)c2C(=O)c2cc(O)c(O)c(O)c21 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
|
Name: In vitro toxicity against human bone marrow stem cells (CFU-GM) in the absence (contr...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653852
|
|
Name: In vitro toxicity against human bone marrow stem cells(CFU-GM) at a dose of 0.1 uM; a...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653853
|
|
Name: In vitro toxicity against human bone marrow stem cells(CFU-GM) at a dose of 1.0 uM; a...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653854
|
|
Name: In vitro toxicity against human bone marrow stem cells(CFU-GM) at a dose of 10.0 uM; ...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653855
|
|
Name: In vitro toxicity against human bone marrow stem cells(CFU-GM) at a dose of 100.0 uM;...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653856
|
|
Name: In vitro toxicity against human bone marrow stem cells(CFU-GM) at a dose of 5.0 uM; a...
Source: ChEMBL
Target: CFU-GM
External Id: CHEMBL653857
|
| 1,2,3,5,6,7-hexahydroxy-9,10-anthraquinone |
| 1,2,3,5,6,7-hexahydroxyanthracene-9,10-dione |
| 1,2,3,5,6,7-hexahydroxy-9,10-anthracenedione |
| 1,2,3,5,6,7-Hexahydroxy-anthrachinon |
| 9,10-Anthracenedione,1,2,3,5,6,7-hexahydroxy |
| 1,2,3,5,6,7-hexahydroxy-anthraquinone |
| Rufigallol |
| rufigallic acid |