1-(4-Acetyl-1-naphtyloxy)-2-butanone structure
|
Common Name | 1-(4-Acetyl-1-naphtyloxy)-2-butanone | ||
|---|---|---|---|---|
| CAS Number | 73622-76-1 | Molecular Weight | 256.29600 | |
| Density | 1.135g/cm3 | Boiling Point | 440.3ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 1-(4-acetylnaphthalen-1-yl)oxybutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 440.3ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 196.7ºC |
| Exact Mass | 256.11000 |
| PSA | 43.37000 |
| LogP | 3.40030 |
| Index of Refraction | 1.576 |
| InChIKey | NGILSQROLZTVFT-UHFFFAOYSA-N |
| SMILES | CCC(=O)COc1ccc(C(C)=O)c2ccccc12 |
|
~%
1-(4-Acetyl-1-n... CAS#:73622-76-1 |
| Literature: Hunter,W.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 167 - 174 |
|
~%
1-(4-Acetyl-1-n... CAS#:73622-76-1 |
| Literature: Hunter,W.H. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 167 - 174 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-Acetyl-1-naphthoxy)-butanon-(2) |
| 1'-ACETONAPHTHONE,4'-(2-OXOBUTOXY) |
| 1-[(4-acetylnaphthalen-1-yl)oxy]butan-2-one |
| 4'-(2-Oxobutoxy)-1'-acetonaphthone |
| 2-Butanone,1-(4-acetyl-1-naphthyloxy) |
| (4-Acetyl-1-naphthoxy)-2-butanone |