(H-Cys-Tyr-OH)2 (Disulfide bond) structure
|
Common Name | (H-Cys-Tyr-OH)2 (Disulfide bond) | ||
|---|---|---|---|---|
| CAS Number | 7369-94-0 | Molecular Weight | 566.64700 | |
| Density | 1.48 g/cm3 | Boiling Point | 959ºC at 760 mmHg | |
| Molecular Formula | C24H30N4O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 533.8ºC | |
Use of (H-Cys-Tyr-OH)2 (Disulfide bond)(H-Cys-Tyr-OH)2 is a biologically active peptide. |
| Name | 2-[[2-amino-3-[[2-amino-3-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-oxopropyl]disulfanyl]propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (H-Cys-Tyr-OH)2 is a biologically active peptide. |
|---|---|
| Related Catalog |
| Density | 1.48 g/cm3 |
|---|---|
| Boiling Point | 959ºC at 760 mmHg |
| Molecular Formula | C24H30N4O8S2 |
| Molecular Weight | 566.64700 |
| Flash Point | 533.8ºC |
| Exact Mass | 566.15100 |
| PSA | 275.90000 |
| LogP | 2.24020 |
| Index of Refraction | 1.673 |
| InChIKey | ZZWGDFPODQWICQ-UHFFFAOYSA-N |
| SMILES | NC(CSSCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| 2-[[2-amino-3-[[2-amino-3-[[1-hydroxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-oxopropyl]disulfanyl]propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| N-(2-Amino-3-((2-amino-3-((1-carboxy-2-(4-hydroxyphenyl)ethyl)amino)-3-oxopropyl)dithio)propanoyl)-4-hydroxyphenylalanine |
| (H-CYS-TYR-OH)2 |