H-Cys-Thr-Thr-His-Trp-Gly-Phe-Thr-Leu-Cys-OH (Disulfide bond)
Modify Date: 2025-08-23 11:02:40
H-Cys-Thr-Thr-His-Trp-Gly-Phe-Thr-Leu-Cys-OH (Disulfide bond) structure
|
Common Name | H-Cys-Thr-Thr-His-Trp-Gly-Phe-Thr-Leu-Cys-OH (Disulfide bond) | ||
|---|---|---|---|---|
| CAS Number | 244082-19-7 | Molecular Weight | 1166.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C52H71N13O14S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Cys-Thr-Thr-His-Trp-Gly-Phe-Thr-Leu-Cys-OH (Disulfide bond)CTTHWGFTLC, CYCLIC is a cyclic peptide inhibitor for matrix metalloproteinases MMP-2 and MMP-9[1]. |
| Name | CTTHWGFTLC (disulfide bond: 1-10) |
|---|---|
| Synonym | More Synonyms |
| Description | CTTHWGFTLC, CYCLIC is a cyclic peptide inhibitor for matrix metalloproteinases MMP-2 and MMP-9[1]. |
|---|---|
| Related Catalog | |
| Target |
MMP-2 MMP-9 |
| References |
| Molecular Formula | C52H71N13O14S2 |
|---|---|
| Molecular Weight | 1166.33 |
| Exact Mass | 1165.47000 |
| PSA | 480.98000 |
| LogP | 0.56840 |
| InChIKey | YAJDFZGRPZQVJN-JIYQNHPRSA-N |
| SMILES | CC(C)CC1NC(=O)C(C(C)O)NC(=O)C(Cc2ccccc2)NC(=O)CNC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(Cc2cnc[nH]2)NC(=O)C(C(C)O)NC(=O)C(C(C)O)NC(=O)C(N)CSSCC(C(=O)O)NC1=O |
| h-cys-thr-thr-his-trp-gly-phe-thr-leu-cys-oh |