Lidanserin structure
|
Common Name | Lidanserin | ||
|---|---|---|---|---|
| CAS Number | 73725-85-6 | Molecular Weight | 454.53400 | |
| Density | 1.192g/cm3 | Boiling Point | 658.6ºC at 760 mmHg | |
| Molecular Formula | C26H31FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.1ºC | |
Use of LidanserinLidanserin is a drug which acts as a combined 5-HT2A and α1-adrenergic receptor antagonist. |
| Name | 4-[3-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxy]-4-methoxyphenyl]pyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Lidanserin is a drug which acts as a combined 5-HT2A and α1-adrenergic receptor antagonist. |
|---|---|
| Related Catalog | |
| Target |
5-HT2AA and α1-adrenergic receptor |
| In Vitro | Lidanserin is a combined 5-HT2A and α1-adrenergic receptor antagonist. Lidanserin is uaed as an antihypertensive agent. |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 658.6ºC at 760 mmHg |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.53400 |
| Flash Point | 352.1ºC |
| Exact Mass | 454.22700 |
| PSA | 67.87000 |
| LogP | 4.06830 |
| Index of Refraction | 1.56 |
| InChIKey | JDYWZVJXSMADHP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CNC(=O)C2)cc1OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| Storage condition | 2-8℃ |
| 4-(3-{3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxy}-4-methoxyphenyl)pyrrolidin-2-one |
| Lidanserinum |
| Lidanserin |
| Lidanserine |
| ( inverted exclamation markA)-4-(3-(3-(4-(p-fluorobenzoyl)piperidino)propoxy)-4-methoxyphenyl)-2-pyrrolidinone |
| Lidanserina |
| Lidanserine [INN-French] |