1-methoxy-4-(2-methylsulfonyloxyethyl)benzene
1-methoxy-4-(2-methylsulfonyloxyethyl)benzene structure
|
Common Name | 1-methoxy-4-(2-methylsulfonyloxyethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 73735-36-1 | Molecular Weight | 230.28100 | |
| Density | 1.211g/cm3 | Boiling Point | 397.8ºC at 760 mmHg | |
| Molecular Formula | C10H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxyphenyl ethanolmethanesulfonate ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760 mmHg |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28100 |
| Flash Point | 194.4ºC |
| Exact Mass | 230.06100 |
| PSA | 60.98000 |
| LogP | 2.29470 |
| Index of Refraction | 1.517 |
| InChIKey | ORTPEEDBOZIXNC-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCOS(C)(=O)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
1-methoxy-4-(2-... CAS#:73735-36-1 |
| Literature: Turtle, Eric; Chow, Nicholas; Yang, Charles; Sosa, Sergio; Bauer, Udo; Brenner, Mitch; Solow-Cordero, David; Ho, Wen-Bin Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 24 p. 7397 - 7401 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 5 | |
CAS#:68844-77-9
CAS#:55-81-2
CAS#:73736-50-2![2-[2-(4-methoxyphenyl)ethylamino]ethanol structure](https://image.chemsrc.com/caspic/457/113733-05-4.png)
CAS#:113733-05-4
CAS#:74447-44-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: SMILES notation of 4-methoxyphenyl ethanolmethanesulfonate ester is COc1ccc(CCOS(C)(=O)=O)cc1. |
| Q: What are the upstream materials of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: Related upstream materials(CAS) of 4-methoxyphenyl ethanolmethanesulfonate ester: 702-23-8;124-63-0. |
| Q: What is the Chinese name of 73735-36-1? |
| A: Chinese name of 73735-36-1 is 73735-36-1. |
| Q: What is the boiling point of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: Boiling point of 4-methoxyphenyl ethanolmethanesulfonate ester is 397.8ºC at 760 mmHg. |
| Q: What is the LogP of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: LogP of 4-methoxyphenyl ethanolmethanesulfonate ester is 2.29470. |
| Q: What is the molecular weight of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: Molecular weight of 4-methoxyphenyl ethanolmethanesulfonate ester is 230.28100. |
| Q: What is the English name of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: The English name of 4-methoxyphenyl ethanolmethanesulfonate ester is 4-methoxyphenyl ethanolmethanesulfonate ester. |
| Q: What is the polar surface area (PSA) of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: Polar surface area (PSA) of 4-methoxyphenyl ethanolmethanesulfonate ester is 60.98000. |
| Q: What are the downstream products of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: Related downstream products(CAS) of 4-methoxyphenyl ethanolmethanesulfonate ester: 68844-77-9;55-81-2;73736-50-2;113733-05-4;74447-44-2. |
| Q: What is the CAS number of 4-methoxyphenyl ethanolmethanesulfonate ester? |
| A: CAS number of 4-methoxyphenyl ethanolmethanesulfonate ester is 73735-36-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |