(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl) 2-chloroacetate structure
|
Common Name | (4,4,5,5-tetramethyl-1,3-dioxolan-2-yl) 2-chloroacetate | ||
|---|---|---|---|---|
| CAS Number | 73761-36-1 | Molecular Weight | 222.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4,4,5,5-tetramethyl-1,3-dioxolan-2-yl) 2-chloroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H15ClO4 |
|---|---|
| Molecular Weight | 222.66600 |
| Exact Mass | 222.06600 |
| PSA | 44.76000 |
| LogP | 1.65600 |
| InChIKey | UIINPVSSFNRBHB-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(OC(=O)CCl)OC1(C)C |
|
~80%
(4,4,5,5-tetram... CAS#:73761-36-1 |
| Literature: Capon, Brian; Grieve, Duncan McL. A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 300 - 305 |
|
~%
(4,4,5,5-tetram... CAS#:73761-36-1 |
| Literature: Capon, Brian; Grieve, Duncan McL. A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 300 - 305 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-chloroacetoxy-4,4,5,5-tetramethyl-1,3-dioxolane |
| Acetic acid,chloro-,4,4,5,5-tetramethyl-1,3-dioxolan-2-yl ester |