ethyl 3,4-difluorobenzoylformate structure
|
Common Name | ethyl 3,4-difluorobenzoylformate | ||
|---|---|---|---|---|
| CAS Number | 73790-05-3 | Molecular Weight | 214.16600 | |
| Density | 1.291 g/cm3 | Boiling Point | 285.3ºC at 760 mmHg | |
| Molecular Formula | C10H8F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.5ºC | |
| Name | ethyl 2-(3,4-difluorophenyl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291 g/cm3 |
|---|---|
| Boiling Point | 285.3ºC at 760 mmHg |
| Molecular Formula | C10H8F2O3 |
| Molecular Weight | 214.16600 |
| Flash Point | 122.5ºC |
| Exact Mass | 214.04400 |
| PSA | 43.37000 |
| LogP | 1.71060 |
| Index of Refraction | 1.482 |
| InChIKey | DYIBSNLBZKOXNA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1ccc(F)c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2918300090 |
|
~%
ethyl 3,4-diflu... CAS#:73790-05-3 |
| Literature: Journal of Organic Chemistry, , vol. 45, # 14 p. 2883 - 2887 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 3,4-difluorobenzoylformate |
| MFCD01319619 |
| Ethyl 3,4-difluorophenylglyoxylate |