2-(4-methylphenyl)sulfonyloxynaphthalene structure
|
Common Name | 2-(4-methylphenyl)sulfonyloxynaphthalene | ||
|---|---|---|---|---|
| CAS Number | 7385-85-5 | Molecular Weight | 298.35600 | |
| Density | 1.277g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C17H14O3S | Melting Point | 125 °C | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | 2-Naphthyl p-Toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Melting Point | 125 °C |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.35600 |
| Flash Point | 242.1ºC |
| Exact Mass | 298.06600 |
| PSA | 51.75000 |
| LogP | 4.99670 |
| Index of Refraction | 1.64 |
| InChIKey | CWCMQKWNHUXBFQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3ccccc3c2)cc1 |
|
~96%
2-(4-methylphen... CAS#:7385-85-5 |
| Literature: Reddy, M. B. Madhusudana; Pasha Phosphorus, Sulfur and Silicon and the Related Elements, 2011 , vol. 186, # 9 p. 1867 - 1875 |
|
~%
2-(4-methylphen... CAS#:7385-85-5 |
| Literature: Bourne et al. Journal of the Chemical Society, 1949 , p. 2976,2978 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| naphthalen-2-yl 4-methylbenzenesulfonate |