11-Oxo etiocholanolone structure
|
Common Name | 11-Oxo etiocholanolone | ||
|---|---|---|---|---|
| CAS Number | 739-27-5 | Molecular Weight | 304.42400 | |
| Density | 1.152g/cm3 | Boiling Point | 453.4ºC at 760 mmHg | |
| Molecular Formula | C19H28O3 | Melting Point | 186-189°C (lit.) | |
| MSDS | N/A | Flash Point | 242.1ºC | |
Use of 11-Oxo etiocholanolone11-Oxo etiocholanolone (11-Ketoetiocholanolone) is a metabolite of Etiocholanolone. Etiocholanolone is the excreted metabolite of testosterone and has anticonvulsant activity[1][2]. |
| Name | 3.α.-Hydroxy-11,17-dioxo-5.β.-androstane |
|---|---|
| Synonym | More Synonyms |
| Description | 11-Oxo etiocholanolone (11-Ketoetiocholanolone) is a metabolite of Etiocholanolone. Etiocholanolone is the excreted metabolite of testosterone and has anticonvulsant activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 453.4ºC at 760 mmHg |
| Melting Point | 186-189°C (lit.) |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.42400 |
| Flash Point | 242.1ºC |
| Exact Mass | 304.20400 |
| PSA | 54.37000 |
| LogP | 3.13810 |
| Index of Refraction | 1.545 |
| InChIKey | IUNYGQONJQTULL-UKZLPJRTSA-N |
| SMILES | CC12CC(=O)C3C(CCC4CC(O)CCC43C)C1CCC2=O |
| Storage condition | 2-8°C |
|
~%
11-Oxo etiochol... CAS#:739-27-5 |
| Literature: Steroids, , vol. 64, # 11 p. 770 - 779 |
|
~%
11-Oxo etiochol... CAS#:739-27-5 |
| Literature: Journal of Biological Chemistry, , vol. 162, p. 601,6307 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Oxoetiocholanolone |
| 11-ketoetioholanolone |
| 11-Ketoaetiocholanolone |
| 5-Androstan-3a-ol-11,17-dione-d5 |
| Etiocholanol-11-one |
| 11-oxo-etiocholanolone |
| 11-KETOETIOCHOLANOLONE |
| 11-Oxoaetiocholanolone |
| 3-Hydroxyandrostane-11,17-dione |