4-[2,6-bis(4-chlorophenyl)-4-pyridyl]-N,N-dimethylaniline structure
|
Common Name | 4-[2,6-bis(4-chlorophenyl)-4-pyridyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 73910-97-1 | Molecular Weight | 419.34600 | |
| Density | 1.231g/cm3 | Boiling Point | 547.1ºC at 760 mmHg | |
| Molecular Formula | C25H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7ºC | |
| Name | 4-[2,6-bis(4-chlorophenyl)pyridin-4-yl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 547.1ºC at 760 mmHg |
| Molecular Formula | C25H20Cl2N2 |
| Molecular Weight | 419.34600 |
| Flash Point | 284.7ºC |
| Exact Mass | 418.10000 |
| PSA | 16.13000 |
| LogP | 7.45540 |
| Index of Refraction | 1.637 |
| InChIKey | YDPVTJYRGIAUIY-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccc(Cl)cc3)nc(-c3ccc(Cl)cc3)c2)cc1 |
|
~79%
4-[2,6-bis(4-ch... CAS#:73910-97-1 |
| Literature: Safari, Javad; Zarnegar, Zohre; Borujeni, Mahmoud Borjian Chemical Papers, 2013 , vol. 67, # 7 p. 688 - 695 |
|
~48%
4-[2,6-bis(4-ch... CAS#:73910-97-1 |
| Literature: Tewari, R. S.; Misra, N. K.; Dubey, A. K. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 953 - 955 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-[2,6-bis-(4-chloro-phenyl)-pyridin-4-yl]-N,N-dimethyl-aniline |
| 4-(2,6-Bis(4-chlorophenyl)-4-pyridyl)-N,N-dimethylaniline |
| EINECS 277-631-5 |