2-[2-(4-nitrophenyl)ethenyl]-1,3-benzoxazole structure
|
Common Name | 2-[2-(4-nitrophenyl)ethenyl]-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 73916-04-8 | Molecular Weight | 266.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(4-nitrophenyl)ethenyl]-1,3-benzoxazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N2O3 |
|---|---|
| Molecular Weight | 266.25200 |
| Exact Mass | 266.06900 |
| PSA | 71.85000 |
| LogP | 4.42960 |
| InChIKey | WEUTXRYVWAJZJV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2nc3ccccc3o2)cc1 |
|
~80%
2-[2-(4-nitroph... CAS#:73916-04-8 |
| Literature: Arient, Josef Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 11 p. 3160 - 3165 |
|
~90%
2-[2-(4-nitroph... CAS#:73916-04-8 |
| Literature: Lokhande, S. B.; Rangnekar, D. W. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 485 - 488 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(Benzoxazolyl-2)-2-(4-nitro-phenyl)-aethylen |
| Benzoxazole,2-[2-(4-nitrophenyl)ethenyl] |
| 2-(4-nitro-styryl)-benzooxazole |
| 3-(4-Nitrostyryl)-1,2-benzoxazol |
| 1-(Benzoxazol-2-yl)-2-(p-nitrophenyl)ethylen |