3,5-DICHLORO-2-HYDROXYBENZOPHENONE structure
|
Common Name | 3,5-DICHLORO-2-HYDROXYBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 7396-92-1 | Molecular Weight | 267.10700 | |
| Density | 1.406g/cm3 | Boiling Point | 376.5ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O2 | Melting Point | 115ºC | |
| MSDS | N/A | Flash Point | 181.5ºC | |
| Name | (3,5-dichloro-2-hydroxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 376.5ºC at 760 mmHg |
| Melting Point | 115ºC |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.10700 |
| Flash Point | 181.5ºC |
| Exact Mass | 265.99000 |
| PSA | 37.30000 |
| LogP | 3.93000 |
| Index of Refraction | 1.631 |
| InChIKey | KQEKLTCGLCEOFY-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc(Cl)cc(Cl)c1O |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36-S37-S39 |
| HS Code | 2914700090 |
|
~43%
3,5-DICHLORO-2-... CAS#:7396-92-1 |
| Literature: Moure, Maria J.; Sanmartin, Raul; Dominguez, Esther Angewandte Chemie - International Edition, 2012 , vol. 51, # 13 p. 3220 - 3224 |
|
~%
3,5-DICHLORO-2-... CAS#:7396-92-1 |
| Literature: Dow Chem.Co. Patent: US2419553 , 1945 ; |
|
~%
3,5-DICHLORO-2-... CAS#:7396-92-1 |
| Literature: Anschuetz; Shores Justus Liebigs Annalen der Chemie, 1906 , vol. 346, p. 382 |
|
~%
3,5-DICHLORO-2-... CAS#:7396-92-1
Detail
|
| Literature: Dow Chem. Co. Patent: US2419553 , 1945 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Benzophenone,3,5-dichloro-2-hydroxy |
| 3,5-dichloro-2-hydroxyphenyl phenyl ketone |
| 3,5-Dichlor-2-hydroxy-benzophenon |
| 2-hydroxy-3,5-dichloro-benzophone |
| (3,5-dichloro-2-hydroxyphenyl)phenyl-methanone |
| 3,5-dichloro-2-hydroxybenzophenone |
| 2-hydroxy-3,5-dicloro benzophenone |