N-(4-amino-3,5-dichloro-phenyl)acetamide structure
|
Common Name | N-(4-amino-3,5-dichloro-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7402-53-1 | Molecular Weight | 219.06800 | |
| Density | 1.473g/cm3 | Boiling Point | 287.3ºC at 760 mmHg | |
| Molecular Formula | C8H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6ºC | |
| Name | N-(4-amino-3,5-dichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 287.3ºC at 760 mmHg |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.06800 |
| Flash Point | 127.6ºC |
| Exact Mass | 218.00100 |
| PSA | 55.12000 |
| LogP | 3.18820 |
| Index of Refraction | 1.654 |
| InChIKey | AWRLPYQRPGYTBM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)c(N)c(Cl)c1 |
|
~%
N-(4-amino-3,5-... CAS#:7402-53-1 |
| Literature: Morgan; Cleage Journal of the Chemical Society, 1918 , vol. 113, p. 592 |
|
~%
N-(4-amino-3,5-... CAS#:7402-53-1 |
| Literature: Morgan; Cleage Journal of the Chemical Society, 1918 , vol. 113, p. 592 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,6-Dichlor-4-acetamido-anilin |
| acetic acid-(4-amino-3,5-dichloro-anilide) |
| Essigsaeure-(4-amino-3,5-dichlor-anilid) |
| N4-Acetyl-2.6-dichlor-phenylendiamin-(1.4) |
| N-(4-AMINO-3,5-DICHLORO-PHENYL)ACETAMIDE |
| 4-Amino-3,5-dichloracetanilid |