2,5-dinitro-3,6-diphenyl-1,4-dithiine structure
|
Common Name | 2,5-dinitro-3,6-diphenyl-1,4-dithiine | ||
|---|---|---|---|---|
| CAS Number | 7402-85-9 | Molecular Weight | 358.39200 | |
| Density | 1.52g/cm3 | Boiling Point | 448.9ºC at 760 mmHg | |
| Molecular Formula | C16H10N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | 2,5-dinitro-3,6-diphenyl-1,4-dithiine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 448.9ºC at 760 mmHg |
| Molecular Formula | C16H10N2O4S2 |
| Molecular Weight | 358.39200 |
| Flash Point | 225.3ºC |
| Exact Mass | 358.00800 |
| PSA | 142.24000 |
| LogP | 5.71880 |
| Index of Refraction | 1.742 |
| InChIKey | WOGCYZTZJIAEQP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C1=C(c2ccccc2)SC([N+](=O)[O-])=C(c2ccccc2)S1 |
|
~%
2,5-dinitro-3,6... CAS#:7402-85-9 |
| Literature: Parham et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 850,853 |
|
~%
2,5-dinitro-3,6... CAS#:7402-85-9 |
| Literature: Parham et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 850,853 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Dithiin,2,5-dinitro-3,6-diphenyl |