2,5-dinitro-N-phenyl-fluoren-9-imine
Modify Date: 2025-08-31 17:17:35
2,5-dinitro-N-phenyl-fluoren-9-imine structure
|
Common Name | 2,5-dinitro-N-phenyl-fluoren-9-imine | ||
|---|---|---|---|---|
| CAS Number | 7402-97-3 | Molecular Weight | 345.30800 | |
| Density | 1.44g/cm3 | Boiling Point | 538.1ºC at 760 mmHg | |
| Molecular Formula | C19H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | 2,5-dinitro-N-phenylfluoren-9-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 538.1ºC at 760 mmHg |
| Molecular Formula | C19H11N3O4 |
| Molecular Weight | 345.30800 |
| Flash Point | 279.2ºC |
| Exact Mass | 345.07500 |
| PSA | 104.00000 |
| LogP | 5.69890 |
| Index of Refraction | 1.715 |
| InChIKey | JTNAFCBVVDDGHM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=Nc1ccccc1)c1cccc([N+](=O)[O-])c1-2 |
|
~%
2,5-dinitro-N-p... CAS#:7402-97-3 |
| Literature: Taylor; Fletcher Journal of Organic Chemistry, 1956 , vol. 21, p. 523,525 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Dinitro-fluoren-9-on-phenylimin |
| (2,5-Dinitro-fluoren-9-yliden)-phenyl-amin |
| n-[(9e)-2,5-dinitro-9h-fluoren-9-ylidene]aniline |
| (2,5-Dinitro-fluoren-9-yliden)-anilin |
| (2,5-dinitro-fluoren-9-ylidene)-phenyl-amine |