1,3-Propanediamine,N1,N1-diethyl-N3-(7-methoxy-5-quinoxalinyl) structure
|
Common Name | 1,3-Propanediamine,N1,N1-diethyl-N3-(7-methoxy-5-quinoxalinyl) | ||
|---|---|---|---|---|
| CAS Number | 7403-19-2 | Molecular Weight | 288.38800 | |
| Density | 1.11g/cm3 | Boiling Point | 449.2ºC at 760mmHg | |
| Molecular Formula | C16H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.5ºC | |
| Name | N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 449.2ºC at 760mmHg |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.38800 |
| Flash Point | 225.5ºC |
| Exact Mass | 288.19500 |
| PSA | 50.28000 |
| LogP | 2.85520 |
| Index of Refraction | 1.593 |
| InChIKey | RXLGZQKBOPHDAF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1cc(OC)cc2nccnc12 |
|
~%
1,3-Propanediam... CAS#:7403-19-2 |
| Literature: Gawron; Spoerri Journal of the American Chemical Society, 1945 , vol. 67, p. 514 |
|
~%
1,3-Propanediam... CAS#:7403-19-2 |
| Literature: Gawron; Spoerri Journal of the American Chemical Society, 1945 , vol. 67, p. 514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |