1,3-Propanediamine,N1,N1-diethyl-N3-(7-methoxy-5-quinoxalinyl) structure
|
Common Name | 1,3-Propanediamine,N1,N1-diethyl-N3-(7-methoxy-5-quinoxalinyl) | ||
|---|---|---|---|---|
| CAS Number | 7403-19-2 | Molecular Weight | 288.38800 | |
| Density | 1.11g/cm3 | Boiling Point | 449.2ºC at 760mmHg | |
| Molecular Formula | C16H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 449.2ºC at 760mmHg |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.38800 |
| Flash Point | 225.5ºC |
| Exact Mass | 288.19500 |
| PSA | 50.28000 |
| LogP | 2.85520 |
| Index of Refraction | 1.593 |
| InChIKey | RXLGZQKBOPHDAF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1cc(OC)cc2nccnc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3-Propanediam... CAS#:7403-19-2 |
| Literature: Gawron; Spoerri Journal of the American Chemical Society, 1945 , vol. 67, p. 514 |
|
~%
1,3-Propanediam... CAS#:7403-19-2 |
| Literature: Gawron; Spoerri Journal of the American Chemical Society, 1945 , vol. 67, p. 514 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7403-19-2? |
| A: Chinese name of 7403-19-2 is 7403-19-2. |
| Q: What is the English name of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: The English name of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine. |
| Q: What is the molecular formula of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: Molecular formula of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is C16H24N4O. |
| Q: What is the InChIKey of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: InChIKey of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is RXLGZQKBOPHDAF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: Related upstream materials(CAS) of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine: 7500-07-4;104-77-8. |
| Q: What is the SMILES notation of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: SMILES notation of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is CCN(CC)CCCNc1cc(OC)cc2nccnc12. |
| Q: What is the CAS number of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: CAS number of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is 7403-19-2. |
| Q: What is the LogP of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: LogP of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is 2.85520. |
| Q: What is the boiling point of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: Boiling point of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is 449.2ºC at 760mmHg. |
| Q: What is the molecular weight of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine? |
| A: Molecular weight of N',N'-diethyl-N-(7-methoxyquinoxalin-5-yl)propane-1,3-diamine is 288.38800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |