N-(3-diethylaminopropyl)-N-(7-methoxyquinoxalin-5-yl)-4-methyl-benzenesulfonamide structure
|
Common Name | N-(3-diethylaminopropyl)-N-(7-methoxyquinoxalin-5-yl)-4-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7500-07-4 | Molecular Weight | 442.57400 | |
| Density | 1.215g/cm3 | Boiling Point | 601.5ºC at 760 mmHg | |
| Molecular Formula | C23H30N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.5ºC | |
| Name | N-[3-(diethylamino)propyl]-N-(7-methoxyquinoxalin-5-yl)-4-methylbenzenesulfonamide |
|---|
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 601.5ºC at 760 mmHg |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.57400 |
| Flash Point | 317.5ºC |
| Exact Mass | 442.20400 |
| PSA | 84.01000 |
| LogP | 4.95480 |
| Index of Refraction | 1.599 |
| InChIKey | ZTPYPAVVDJXCNJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCN(c1cc(OC)cc2nccnc12)S(=O)(=O)c1ccc(C)cc1 |
|
~%
N-(3-diethylami... CAS#:7500-07-4 |
| Literature: Gawron; Spoerri Journal of the American Chemical Society, 1945 , vol. 67, p. 514 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |