a-D-Glucopyranose, 6-deoxy-,tetraacetate (9CI)
a-D-Glucopyranose, 6-deoxy-,tetraacetate (9CI) structure
|
Common Name | a-D-Glucopyranose, 6-deoxy-,tetraacetate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7404-35-5 | Molecular Weight | 332.30300 | |
| Density | 1.26±0.1 g/cm3 (20ºC 760 Torr) | Boiling Point | N/A | |
| Molecular Formula | C14H20O9 | Melting Point | 119.5ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26±0.1 g/cm3 (20ºC 760 Torr) |
|---|---|
| Melting Point | 119.5ºC |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.30300 |
| Exact Mass | 332.11100 |
| PSA | 114.43000 |
| LogP | 0.08940 |
| InChIKey | QZQMGQQOGJIDKJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1OC(C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:34819-86-8
CAS#:84635-54-1
CAS#:114853-37-1
CAS#:127501-41-1
CAS#:138552-46-2
CAS#:107802-80-2
CAS#:10231-84-2
CAS#:3359-36-2
CAS#:167612-35-3![2-(4,8,8-trimethyl-5-oxo-3,7,9-trioxabicyclo[4.3.0]non-2-yl)-1,2,4-triazine-3,5-dione structure](https://image.chemsrc.com/caspic/230/73240-32-1.png)
CAS#:73240-32-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tetra-O-acetyl-L-rhamnopyranose |
| a-D-Glucopyranose,6-deoxy-,tetraacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: SMILES notation of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is CC(=O)OC1OC(C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O. |
| Q: What is the molecular weight of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: Molecular weight of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is 332.30300. |
| Q: What is the LogP of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: LogP of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is 0.08940. |
| Q: What is the InChIKey of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: InChIKey of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is QZQMGQQOGJIDKJ-UHFFFAOYSA-N. |
| Q: What is the melting point of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: Melting point of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is 119.5ºC. |
| Q: What are the downstream products of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: Related downstream products(CAS) of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate: 34819-86-8;84635-54-1;114853-37-1;127501-41-1;138552-46-2;107802-80-2;10231-84-2;3359-36-2;167612-35-3;73240-32-1. |
| Q: What is the molecular formula of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: Molecular formula of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is C14H20O9. |
| Q: What is the polar surface area (PSA) of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: Polar surface area (PSA) of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is 114.43000. |
| Q: What is the CAS number of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: CAS number of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is 7404-35-5. |
| Q: What is the English name of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate? |
| A: The English name of (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate is (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |