methyl 2-cyano-5-oxo-2-(3-oxo-3-phenyl-propyl)-5-phenyl-pentanoate structure
|
Common Name | methyl 2-cyano-5-oxo-2-(3-oxo-3-phenyl-propyl)-5-phenyl-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 7404-85-5 | Molecular Weight | 363.40600 | |
| Density | 1.174g/cm3 | Boiling Point | 567.4ºC at 760 mmHg | |
| Molecular Formula | C22H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.6ºC | |
| Name | methyl 2-cyano-5-oxo-2-(3-oxo-3-phenylpropyl)-5-phenylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 567.4ºC at 760 mmHg |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.40600 |
| Flash Point | 243.6ºC |
| Exact Mass | 363.14700 |
| PSA | 84.23000 |
| LogP | 3.99558 |
| Index of Refraction | 1.559 |
| InChIKey | IHHWCIFPTKGKEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)(CCC(=O)c1ccccc1)CCC(=O)c1ccccc1 |
|
~%
methyl 2-cyano-... CAS#:7404-85-5 |
| Literature: Allen; Bell Canadian Journal of Research, 1934 , vol. 11, p. 40,43 |
|
~%
methyl 2-cyano-... CAS#:7404-85-5 |
| Literature: Feuer,H.; Harmetz,R. Journal of Organic Chemistry, 1961 , vol. 26, p. 1061 - 1072 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyan-5-oxo-2-(3-oxo-3-phenyl-propyl)-5-phenyl-valeriansaeure-methylester |
| 2-cyano-5-oxo-2-(3-oxo-3-phenyl-propyl)-5-phenyl-valeric acid methyl ester |
| 3-Methoxycarbonyl-3-cyan-1,5-dibenzoyl-pentan |
| Bis-(3-oxo-3-phenyl-propyl)-malonsaeure-methylester-nitril |
| METHYL 2-CYANO-5-OXO-2-(3-OXO-3-PHENYL-PROPYL)-5-PHENYL-PENTANOATE |