bensulide structure
|
Common Name | bensulide | ||
|---|---|---|---|---|
| CAS Number | 741-58-2 | Molecular Weight | 397.51300 | |
| Density | 1.261g/cm3 | Boiling Point | 487.2ºC at 760 mmHg | |
| Molecular Formula | C14H24NO4PS3 | Melting Point | 34.4°C | |
| MSDS | Chinese USA | Flash Point | 248.4ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | bensulide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 487.2ºC at 760 mmHg |
| Melting Point | 34.4°C |
| Molecular Formula | C14H24NO4PS3 |
| Molecular Weight | 397.51300 |
| Flash Point | 248.4ºC |
| Exact Mass | 397.06100 |
| PSA | 140.21000 |
| LogP | 5.89490 |
| Appearance of Characters | Solid | White |
| Index of Refraction | 1.557 |
| InChIKey | RRNIZKPFKNDSRS-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H410 |
| Precautionary Statements | P273-P301 + P312 + P330-P391-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn;N |
| Risk Phrases | 22-50/53 |
| Safety Phrases | S24;S36;S60;S61 |
| RIDADR | UN 2811 6.1/PG 3 |
| RTECS | TE0250000 |
| HS Code | 29350090 |
|
Detections of eleven organophosphorus insecticides and one herbicide threatening Pacific salmonids, Oncorhynchus spp., in California, 1991-2010.
Bull. Environ. Contam. Toxicol. 87(4) , 355-60, (2011) California's surface water monitoring results from 1991 through 2010 were analyzed to determine whether 12 organophosphorus insecticides and herbicides (i.e., azinphos methyl, bensulide, dimethoate, d... |
|
|
Continuous flow microextraction combined with high-performance liquid chromatography for the analysis of pesticides in natural waters.
J. Chromatogr. A. 1122(1-2) , 7-12, (2006) Continuous flow microextraction (CFME) combined with high-performance liquid chromatography-ultraviolet (HPLC-UV) detection has been applied to the analysis of five widely used pesticides, simazine, f... |
|
|
Mobility and half-life of bensulide in agricultural soil.
J. Environ. Sci. Health B 45(1) , 1-10, (2010) Environmentally and economically viable agriculture requires the use of cultivation practices that maximize agrochemical efficacy while minimizing their off-site movement. Bensulide [O, O-diisopropyl ... |
| Betasan E |
| O,O-diisopropyl S-(2-phenylsulfonaminoethyl) phosphorothioate |
| BENSULIDE |
| Prefer |
| N-(2-mercaptoethyl)benzenesulfonamide S-(O,O-diisopropyl phosphorodithiolate) ester |
| S-2-benzenesulfonamidoethyl O,O-diisopropyl phosphorodithioate |
| EINECS 212-010-4 |
| Exporsan |
| Prefar |
| O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl]phosphorodithioate |
| N-[2-di(propan-2-yloxy)phosphinothioylsulfanylethyl]benzenesulfonamide |
| O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] phosphorodithioate |
| Kayaphenone |
| Disan |
| MFCD00055362 |
| O,O-diisopropyl S-2-phenylsulfonylaminoethyl phosphorodithioate |
| Betasan |
| O,O-diisopropyl-S-(2-benzenesulfonylaminoethyl)-phosphorodithioate |
| S-[2-(benzenesulfonamido)ethyl] O,O-di(propan-2-yl) phosphorodithioate |
| Benzulfide |
| Betamec |