benzyl (4-hydroxyphenyl) carbonate structure
|
Common Name | benzyl (4-hydroxyphenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 74206-92-1 | Molecular Weight | 244.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl (4-hydroxyphenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O4 |
|---|---|
| Molecular Weight | 244.24300 |
| Exact Mass | 244.07400 |
| PSA | 55.76000 |
| LogP | 3.10780 |
| InChIKey | QAVIPIHPKCDJNE-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)Oc1ccc(O)cc1 |
|
~%
benzyl (4-hydro... CAS#:74206-92-1 |
| Literature: Olcott Journal of the American Chemical Society, 1937 , vol. 59, p. 392 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| O-Benzyloxycarbonyl-hydrochinon |
| Carbonic acid,4-hydroxyphenyl phenylmethyl ester |