7-CHLORO-5-NITRO-1H-INDAZOLE structure
|
Common Name | 7-CHLORO-5-NITRO-1H-INDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 74209-22-6 | Molecular Weight | 197.57900 | |
| Density | 1.661g/cm3 | Boiling Point | 397.9ºC at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
| Name | 4-chloro-6-nitro-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.661g/cm3 |
|---|---|
| Boiling Point | 397.9ºC at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.57900 |
| Flash Point | 194.4ºC |
| Exact Mass | 196.99900 |
| PSA | 74.50000 |
| LogP | 2.64770 |
| Index of Refraction | 1.742 |
| InChIKey | YMEJTHJTNCGFPD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c2[nH]ncc2c1 |
| HS Code | 2933990090 |
|---|
|
~%
7-CHLORO-5-NITR... CAS#:74209-22-6 |
| Literature: Binch, Hayley; Brenchley, Guy; Golec, Julian M. C.; Knegtel, Ronald; Mortimore, Michael; Patel, Sanjay; Rutherford, Alistair Patent: US2004/9968 A1, 2004 ; US 20040009968 A1 |
|
~%
7-CHLORO-5-NITR... CAS#:74209-22-6 |
| Literature: Ruechardt, Christoph; Hassmann, Volker Liebigs Annalen der Chemie, 1980 , # 6 p. 908 - 927 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Chlor-5-nitroindazol |
| 7-Chlor-5-nitro-1H-indazol |
| 7-chloro-5-nitroindazole |
| 7-chloro-5-nitro-1(2)H-indazole |
| 7-Chloro-5-nitro-1H-benzimidazole |