4-Chloro-5-nitro-1H-indazole structure
|
Common Name | 4-Chloro-5-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 907958-42-3 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 414.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2±23.2 °C | |
| Name | 4-chloro-5-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.1±25.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 204.2±23.2 °C |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | AXZCWGUWGPLXOR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2[nH]ncc2c1Cl |
| HS Code | 2933990090 |
|---|
|
~%
4-Chloro-5-nitr... CAS#:907958-42-3 |
| Literature: Petitcolas; Sureau Bulletin de la Societe Chimique de France, 1950 , p. 466,476 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole, 4-chloro-5-nitro- |
| 4-Chloro-5-nitro-1H-indazole |
| 4-chloro-5-nitro-1(2)H-indazole |
| 4-Chlor-5-nitro-1(2)H-indazol |
| 4-Chloro-5-nitro-(1H)indazole |