7-Acetylintermedine structure
|
Common Name | 7-Acetylintermedine | ||
|---|---|---|---|---|
| CAS Number | 74243-01-9 | Molecular Weight | 341.399 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 466.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6±28.7 °C | |
Use of 7-Acetylintermedine7-Acetylintermedine is a hepatotoxic botanical pyrrolizidine alkaloid[1]. |
| Name | Acetylintermedine |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Acetylintermedine is a hepatotoxic botanical pyrrolizidine alkaloid[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 7-Acetylintermedine is positive for liver necrosis and possess hepatotoxicity alerts at their pyrroline positions[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.0±45.0 °C at 760 mmHg |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.399 |
| Flash Point | 235.6±28.7 °C |
| Exact Mass | 341.183838 |
| LogP | 0.16 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | RKDOFSJTBIDAHX-CYHLAULCSA-N |
| SMILES | CC(=O)OC1CCN2CC=C(COC(=O)C(O)(C(C)C)C(C)O)C12 |
| [(1R,7aR)-1-(acetyloxy)-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2S,3R)-2,3-dihydroxy-2-(propan-2-yl)butanoate |
| Acetylintermedine |
| [(1R,7aR)-1-Acetoxy-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2S,3R)-2,3-dihydroxy-2-isopropylbutanoate |