phenyl diphenoxyphosphorylformate structure
|
Common Name | phenyl diphenoxyphosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 74270-16-9 | Molecular Weight | 354.29300 | |
| Density | 1.304g/cm3 | Boiling Point | 461.4ºC at 760 mmHg | |
| Molecular Formula | C19H15O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.1ºC | |
| Name | phenyl diphenoxyphosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 461.4ºC at 760 mmHg |
| Molecular Formula | C19H15O5P |
| Molecular Weight | 354.29300 |
| Flash Point | 246.1ºC |
| Exact Mass | 354.06600 |
| PSA | 71.64000 |
| LogP | 5.53650 |
| Index of Refraction | 1.595 |
| InChIKey | BWTSONJQZUGZDC-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
phenyl diphenox... CAS#:74270-16-9 |
| Literature: Moss, Robert A.; Morales-Rojas, Hugo; Vijayaraghavan, Saketh; Tian, Jingzhi Journal of the American Chemical Society, 2004 , vol. 126, # 35 p. 10923 - 10936 |
|
~%
phenyl diphenox... CAS#:74270-16-9 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phosphinecarboxylic acid,diphenoxy-,phenyl ester,oxide |
| phenyl diphenoxyphosphinecarboxylate oxide |