Ethanone,1-(4-aminophenyl)-, 2-[1-(4-aminophenyl)ethylidene]hydrazone structure
|
Common Name | Ethanone,1-(4-aminophenyl)-, 2-[1-(4-aminophenyl)ethylidene]hydrazone | ||
|---|---|---|---|---|
| CAS Number | 74277-70-6 | Molecular Weight | 266.34100 | |
| Density | 1.13g/cm3 | Boiling Point | 440.7ºC at 760mmHg | |
| Molecular Formula | C16H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 4-[(E)-N-[(E)-1-(4-aminophenyl)ethylideneamino]-C-methylcarbonimidoyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 440.7ºC at 760mmHg |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.34100 |
| Flash Point | 220.3ºC |
| Exact Mass | 266.15300 |
| PSA | 76.76000 |
| LogP | 4.24660 |
| Index of Refraction | 1.605 |
| InChIKey | WCTYTFXVBQIUHH-AYKLPDECSA-N |
| SMILES | CC(=NN=C(C)c1ccc(N)cc1)c1ccc(N)cc1 |
|
~39%
Ethanone,1-(4-a... CAS#:74277-70-6 |
| Literature: Giamberini; Amendola; Carfagna Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, 1995 , vol. 266, p. 9 - 22 |
|
~%
Ethanone,1-(4-a... CAS#:74277-70-6 |
| Literature: Peet, Norton P.; Sunder, Shyam Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 593 - 595 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-Amino-phenyl)-aethanon-(1)-azin |
| Methyl-(4-amino-phenyl)-ketazin |
| p-Aminoacetophenone azine |
| symm. Dimethyl-bis-(4-amino-phenyl)-azimethylen |
| Bis-[1-(4-amino-phenyl)-aethyliden]-hydrazin |
| 4,4'-[(1E,2E)-hydrazine-1,2-diylidenedi(1E)eth-1-yl-1-ylidene]dianiline |
| bis-[1-(4-amino-phenyl)-ethylidene]-hydrazine |
| 1(4-aminophenyl)ethanone <1-(4-aminophenyl)ethylidene>hydrazone |