6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxo-hexanoic acid structure
|
Common Name | 6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxo-hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 74294-94-3 | Molecular Weight | 514.77900 | |
| Density | 1.05g/cm3 | Boiling Point | 606.5ºC at 760 mmHg | |
| Molecular Formula | C33H54O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 606.5ºC at 760 mmHg |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.77900 |
| Flash Point | 182.7ºC |
| Exact Mass | 514.40200 |
| PSA | 63.60000 |
| LogP | 8.58460 |
| Index of Refraction | 1.526 |
| InChIKey | XPWINNJHPSXNPE-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCCCC(=O)O)CCC4(C)C3CCC12C |
|
~56%
6-[[10,13-dimet... CAS#:74294-94-3 |
| Literature: Yao, Dan-Shu; Zhang, Bao-Yan; Zhang, Wei-Wei; Tian, Mei Journal of Molecular Structure, 2008 , vol. 881, # 1-3 p. 83 - 89 |
|
~%
6-[[10,13-dimet... CAS#:74294-94-3 |
| Literature: Page; Rudy Biochemische Zeitschrift, 1930 , vol. 220, p. 304,308, 321 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Adipinsaeure-monocholesterylester |
| Cholesterol Enanthate |
| cholesteryl hydrogenadipate |
| Heptansaeure-cholesterylester |
| hexanedioic acid monocholesterol ester |
| O-Heptanoyl-cholesterin |
| cholesteryl heptylate |
| cholesteryl heptanoate |
| Cholesteryl-hydrogenadipat |
| Cholesterol Heptanoate |
| Cholesteryl enanthate |