5-bromo-ethylenediamine-N,N'-bis(2-hydroxyphenylacetic acid) structure
|
Common Name | 5-bromo-ethylenediamine-N,N'-bis(2-hydroxyphenylacetic acid) | ||
|---|---|---|---|---|
| CAS Number | 74304-83-9 | Molecular Weight | 518.15300 | |
| Density | 1.807g/cm3 | Boiling Point | 690.1ºC at 760 mmHg | |
| Molecular Formula | C18H18Br2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.2ºC | |
| Name | 2-(5-bromo-2-hydroxyphenyl)-2-[2-[[(5-bromo-2-hydroxyphenyl)-carboxymethyl]amino]ethylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.807g/cm3 |
|---|---|
| Boiling Point | 690.1ºC at 760 mmHg |
| Molecular Formula | C18H18Br2N2O6 |
| Molecular Weight | 518.15300 |
| Flash Point | 371.2ºC |
| Exact Mass | 515.95300 |
| PSA | 139.12000 |
| LogP | 3.53540 |
| Index of Refraction | 1.679 |
| InChIKey | ZIXYCTFWCCSCBN-UHFFFAOYSA-N |
| SMILES | O=C(O)C(NCCNC(C(=O)O)c1cc(Br)ccc1O)c1cc(Br)ccc1O |
|
~30%
5-bromo-ethylen... CAS#:74304-83-9 |
| Literature: Theodorakis; Groutas; Bermudez; Magnin; Stefanakou Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 5 p. 581 - 584 |
|
~%
5-bromo-ethylen... CAS#:74304-83-9 |
| Literature: Wilson, Gerald J. Australian Journal of Chemistry, 1987 , vol. 40, # 10 p. 1695 - 1704 |
| 5-Bromo-eddha |