[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]oxirane structure
|
Common Name | [2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]oxirane | ||
|---|---|---|---|---|
| CAS Number | 74328-57-7 | Molecular Weight | 226.09200 | |
| Density | 0.975 g/mL at 25ºC(lit.) | Boiling Point | 81ºC(lit.) | |
| Molecular Formula | C6H5F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71 °F | |
| Name | [2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 81ºC(lit.) |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09200 |
| Flash Point | 71 °F |
| Exact Mass | 226.02300 |
| PSA | 12.53000 |
| LogP | 2.60820 |
| Index of Refraction | n20/D 1.32(lit.) |
| InChIKey | ZCSHSWXXDMBWOP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(CC1CO1)C(F)(F)F |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00155997 |
| (2,3,3,3-tetrafluoro-2-(trifluoromethyl)-propyl)o |
| 3-(perfluoro-1-methylethyl)-1,2-epoxypropane |
| [(heptafluoroisopropyl)methyl]oxirane |