Thiourea,N,N'-bis[4-(diethylamino)phenyl]- structure
|
Common Name | Thiourea,N,N'-bis[4-(diethylamino)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 74347-02-7 | Molecular Weight | 370.55500 | |
| Density | 1.158g/cm3 | Boiling Point | 510.4ºC at 760mmHg | |
| Molecular Formula | C21H30N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.5ºC | |
| Name | 1,3-bis[4-(diethylamino)phenyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 510.4ºC at 760mmHg |
| Molecular Formula | C21H30N4S |
| Molecular Weight | 370.55500 |
| Flash Point | 262.5ºC |
| Exact Mass | 370.21900 |
| PSA | 62.63000 |
| LogP | 5.33390 |
| Index of Refraction | 1.67 |
| InChIKey | RKSXRIRGAXTYTH-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(NC(=S)Nc2ccc(N(CC)CC)cc2)cc1 |
|
~%
Thiourea,N,N'-b... CAS#:74347-02-7 |
| Literature: Naunton Journal of the Society of Chemical Industry, London, 1926 , vol. 45, p. 378 T Chem. Zentralbl., 1927 , vol. 98, # I p. 368 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Bis-(4-diaethylamino-phenyl)-thioharnstoff |
| N,N'-bis-(4-diethylamino-phenyl)-thiourea |