hexafluoroisopropyl 2-fluoroacrylate structure
|
Common Name | hexafluoroisopropyl 2-fluoroacrylate | ||
|---|---|---|---|---|
| CAS Number | 74359-06-1 | Molecular Weight | 240.07600 | |
| Density | 1.453 | Boiling Point | 46.8ºC | |
| Molecular Formula | C6H3F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 27.1ºC | |
| Name | 1,1,1,2,3,3-hexafluoropropan-2-yl 2-fluoroprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453 |
|---|---|
| Boiling Point | 46.8ºC |
| Molecular Formula | C6H3F7O2 |
| Molecular Weight | 240.07600 |
| Flash Point | 27.1ºC |
| Exact Mass | 240.00200 |
| PSA | 26.30000 |
| LogP | 2.50600 |
| Index of Refraction | 1.3145 |
| InChIKey | RNMOMNJMYZWWGF-UHFFFAOYSA-N |
| SMILES | C=C(F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 10 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 3272 |
| HS Code | 2916190090 |
|
~%
hexafluoroisopr... CAS#:74359-06-1 |
| Literature: US2004/24243 A1, ; |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2-Propenoic acid,2-fluoro-,2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester |
| MFCD03094251 |
| 2-fluoro-2-propenoic acid 1,1,1,2,3,3-hexafluoropropan-2-yl ester |
| 1,1,1,2,3,3-hexakis(fluoranyl)propan-2-yl 2-fluoranylprop-2-enoate |
| Hexafluoroisopropyl 2-fluoroacrylate |
| 1,1,1,3,3,3,-hexafluoro-2-propyl 2-fluoroacrylate |