phenyl 2-(2-methoxyphenyl)acetate
phenyl 2-(2-methoxyphenyl)acetate structure
|
Common Name | phenyl 2-(2-methoxyphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 74384-26-2 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenyl 2-(2-methoxyphenyl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 2.84330 |
| InChIKey | ZKIRVFKSFKESAD-UHFFFAOYSA-N |
| SMILES | COc1ccccc1CC(=O)Oc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
phenyl 2-(2-met... CAS#:74384-26-2 |
| Literature: Martin, Robert; Gros, Nicole; Boehmer, Volker; Kaemmerer, Hermann Monatshefte fuer Chemie, 1980 , vol. 111, p. 81 - 92 |
|
~80%
phenyl 2-(2-met... CAS#:74384-26-2 |
| Literature: Martin, Robert; Gros, Nicole; Boehmer, Volker; Kaemmerer, Hermann Monatshefte fuer Chemie, 1980 , vol. 111, p. 81 - 92 |
|
~%
phenyl 2-(2-met... CAS#:74384-26-2 |
| Literature: Martin, Robert; Gros, Nicole; Boehmer, Volker; Kaemmerer, Hermann Monatshefte fuer Chemie, 1980 , vol. 111, p. 81 - 92 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 74384-26-2? |
| A: Chinese name of 74384-26-2 is 74384-26-2. |
| Q: What is the English name of phenyl 2-(2-methoxyphenyl)acetate? |
| A: The English name of phenyl 2-(2-methoxyphenyl)acetate is phenyl 2-(2-methoxyphenyl)acetate. |
| Q: What is the SMILES notation of phenyl 2-(2-methoxyphenyl)acetate? |
| A: SMILES notation of phenyl 2-(2-methoxyphenyl)acetate is COc1ccccc1CC(=O)Oc1ccccc1. |
| Q: What is the molecular weight of phenyl 2-(2-methoxyphenyl)acetate? |
| A: Molecular weight of phenyl 2-(2-methoxyphenyl)acetate is 242.27000. |
| Q: What are the upstream materials of phenyl 2-(2-methoxyphenyl)acetate? |
| A: Related upstream materials(CAS) of phenyl 2-(2-methoxyphenyl)acetate: 28033-63-8;108-95-2;93-25-4. |
| Q: What is the molecular formula of phenyl 2-(2-methoxyphenyl)acetate? |
| A: Molecular formula of phenyl 2-(2-methoxyphenyl)acetate is C15H14O3. |
| Q: What is the InChIKey of phenyl 2-(2-methoxyphenyl)acetate? |
| A: InChIKey of phenyl 2-(2-methoxyphenyl)acetate is ZKIRVFKSFKESAD-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of phenyl 2-(2-methoxyphenyl)acetate? |
| A: Polar surface area (PSA) of phenyl 2-(2-methoxyphenyl)acetate is 35.53000. |
| Q: What is the CAS number of phenyl 2-(2-methoxyphenyl)acetate? |
| A: CAS number of phenyl 2-(2-methoxyphenyl)acetate is 74384-26-2. |
| Q: What is the LogP of phenyl 2-(2-methoxyphenyl)acetate? |
| A: LogP of phenyl 2-(2-methoxyphenyl)acetate is 2.84330. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |