3-(Carboxymethyl)benzothiazolium Bromide structure
|
Common Name | 3-(Carboxymethyl)benzothiazolium Bromide | ||
|---|---|---|---|---|
| CAS Number | 74385-09-4 | Molecular Weight | 274.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO2S | Melting Point | 250ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(Carboxymethyl)benzothiazolium Bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 250ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C9H8BrNO2S |
| Molecular Weight | 274.13400 |
| Exact Mass | 272.94600 |
| PSA | 69.42000 |
| InChIKey | UEINBJHBQWSAHA-UHFFFAOYSA-N |
| SMILES | O=C(O)C[n+]1csc2ccccc21.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934200090 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
A benzothiazole-based semisquarylium dye suitable for highly selective Hg2+ sensing in aqueous media. Bae J-S, et al.
Dyes and Pigments 83(3) , 324-27, (2009)
|
|
|
Aggregation behavior of water soluble bis (benzothiazolylidene) squaraine derivatives in aqueous media. Das S, et al.
J. Phys. Chem. 100(43) , 17310-15, (1996)
|
| 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid,bromide |