Benzobarbital structure
|
Common Name | Benzobarbital | ||
|---|---|---|---|---|
| CAS Number | 744-80-9 | Molecular Weight | 336.341 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 472.83°C (rough estimate) | |
| Molecular Formula | C19H16N2O4 | Melting Point | 134-137ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzobarbital |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.83°C (rough estimate) |
| Melting Point | 134-137ºC |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.341 |
| Exact Mass | 336.110992 |
| PSA | 83.55000 |
| LogP | 2.25 |
| Index of Refraction | 1.600 |
| InChIKey | QMOWPJIFTHVQMB-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N(C(=O)c2ccccc2)C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Hazard Codes | Xi |
|---|---|
| RIDADR | UN 3249 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2933540000 |
|
~60%
Benzobarbital CAS#:744-80-9 |
| Literature: Pharmaceutical Chemistry Journal, , vol. 14, # 3 p. 203 - 204 Khimiko-Farmatsevticheskii Zhurnal, , vol. 14, # 3 p. 102 - 103 |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) signa...
Source: 824
Target: AR protein [Homo sapiens]
External Id: MDAN535
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1100
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1101
|
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) sign...
Source: 824
Target: N/A
External Id: MDAV150
|
|
Name: qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cel...
Source: 824
Target: RecName: Full=ATPase family AAA domain-containing protein 5; AltName: Full=Chromosome fragility-associated gene 1 protein
External Id: ELG271
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: thyroid hormone receptor beta isoform 2 [Rattus norvegicus]
External Id: TRN186
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: N/A
External Id: TRV455
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: Cytotoxic Profiling of Annotated Libraries Using Quantitative High-Throughput Screeni...
Source: NCGC
Target: N/A
External Id: CPF001
|
| 1-benzoyl-5-phenyl-5-ethylbarbituric acid |
| 1-benzoyl-5-ethyl-5-phenylbarbituric acid |
| Benzoyl phenobarbitone |
| BENZOBARBITONE |
| benzoyluminal |
| 1-benzoyl-5-ethyl-5-phenyl-barbituricaci |
| benzonal |
| benzoylluminal |
| 1-benzoyl-5-ethyl-5-phenyl-pyrimidine-2,4,6-trione |
| 5-Ethyl-1-benzoyl-5-phenylbarbituric AAnti-arrhythmiacid |
| Benzobarbita |
| 1-Benzoyl-5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 1-Benzoyl-5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| benzoylphenobarbital |
| Benzobarbital |
| 1-Benzoyl-5-ethyl-5-phenyl barbitoric acid |